C17H21NO3 — CID 608651
5-hydroxy-6-octylquinoline-7,8-dione (PubChem CID 608651) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-hydroxy-6-octylquinoline-7,8-dione.
| Compound Name | 5-hydroxy-6-octylquinoline-7,8-dione |
|---|---|
| PubChem CID | 608651 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-hydroxy-6-octylquinoline-7,8-dione |
| SMILES | CCCCCCCCC1=C(O)c2cccnc2C(=O)C1=O |
| InChI | InChI=1S/C17H21NO3/c1-2-3-4-5-6-7-9-13-15(19)12-10-8-11-18-14(12)17(21)16(13)20/h8,10-11,19H,2-7,9H2,1H3 |
| InChIKey | QCHUMDPSHDHHBQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|