C24H32O5 — CID 45487241
[3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] nonanoate (PubChem CID 45487241) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] nonanoate.
| Compound Name | [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] nonanoate |
|---|---|
| PubChem CID | 45487241 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OCC(C)(C)CC1=C(O)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C24H32O5/c1-4-5-6-7-8-9-14-20(25)29-16-24(2,3)15-19-21(26)17-12-10-11-13-18(17)22(27)23(19)28/h10-13,26H,4-9,14-16H2,1-3H3 |
| InChIKey | RRLSYUQJJSOQMT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|