C17H20 — CID 165145096
2,4-dimethyl-1-[2-(3-methylphenyl)ethyl]benzene (PubChem CID 165145096) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2,4-dimethyl-1-[2-(3-methylphenyl)ethyl]benzene.
| Compound Name | 2,4-dimethyl-1-[2-(3-methylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 165145096 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,4-dimethyl-1-[2-(3-methylphenyl)ethyl]benzene |
| SMILES | Cc1cccc(CCc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C17H20/c1-13-5-4-6-16(12-13)8-10-17-9-7-14(2)11-15(17)3/h4-7,9,11-12H,8,10H2,1-3H3 |
| InChIKey | BGRDILCQIXKGPG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |