C16H18Au — CID 173364905
2,4-dimethyl-1-(2-phenylethyl)benzene;gold (PubChem CID 173364905) has the molecular formula C16H18Au and a molecular weight of 407.29 g/mol. Its IUPAC name is 2,4-dimethyl-1-(2-phenylethyl)benzene;gold.
| Compound Name | 2,4-dimethyl-1-(2-phenylethyl)benzene;gold |
|---|---|
| PubChem CID | 173364905 |
| Molecular Formula | C16H18Au |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2,4-dimethyl-1-(2-phenylethyl)benzene;gold |
| SMILES | Cc1ccc(CCc2ccccc2)c(C)c1.[Au] |
| InChI | InChI=1S/C16H18.Au/c1-13-8-10-16(14(2)12-13)11-9-15-6-4-3-5-7-15;/h3-8,10,12H,9,11H2,1-2H3; |
| InChIKey | NSQDYLYDEQOCNV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |