C19H25N3 — CID 111075809
2-[2-(2,4-dimethylphenyl)ethyl]-1-(2-phenylethyl)guanidine (PubChem CID 111075809) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)ethyl]-1-(2-phenylethyl)guanidine.
| Compound Name | 2-[2-(2,4-dimethylphenyl)ethyl]-1-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111075809 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)ethyl]-1-(2-phenylethyl)guanidine |
| SMILES | Cc1ccc(CC/N=C(\N)NCCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H25N3/c1-15-8-9-18(16(2)14-15)11-13-22-19(20)21-12-10-17-6-4-3-5-7-17/h3-9,14H,10-13H2,1-2H3,(H3,20,21,22) |
| InChIKey | VMDVRYAWLZDFPF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|