About 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol
3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol (PubChem CID 161002126) has the molecular formula C17H22O3
and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol.
Molecular Properties
| Compound Name | 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol |
| PubChem CID | 161002126 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol |
| SMILES | Cc1cccc(CCO)c1.OCCc1cccc(O)c1 |
| InChI | InChI=1S/C9H12O.C8H10O2/c1-8-3-2-4-9(7-8)5-6-10;9-5-4-7-2-1-3-8(10)6-7/h2-4,7,10H,5-6H2,1H3;1-3,6,9-10H,4-5H2 |
| InChIKey | TWAFKDOODXKXOQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol?
The IUPAC name of 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol (CID 161002126) is 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol.
What is the SMILES notation for 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol?
The canonical SMILES for 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol is Cc1cccc(CCO)c1.OCCc1cccc(O)c1.
What is the InChIKey of 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol?
The InChIKey is TWAFKDOODXKXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C8H10O2/c1-8-3-2-4-9(7-8)5-6-10;9-5-4-7-2-1-3-8(10)6-7/h2-4,7,10H,5-6H2,1H3;1-3,6,9-10H,4-5H2.
What are the key properties of 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol?
3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol has a molecular weight of 274.36 g/mol, XLogP of 2.46, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethyl)phenol;2-(3-methylphenyl)ethanol is sourced from PubChem (CID 161002126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).