About 3-(4-hydroxybutyl)phenol
3-(4-hydroxybutyl)phenol (PubChem CID 19991537) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)phenol.
Molecular Properties
| Compound Name | 3-(4-hydroxybutyl)phenol |
| PubChem CID | 19991537 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 3-(4-hydroxybutyl)phenol |
| SMILES | OCCCCc1cccc(O)c1 |
| InChI | InChI=1S/C10H14O2/c11-7-2-1-4-9-5-3-6-10(12)8-9/h3,5-6,8,11-12H,1-2,4,7H2 |
| InChIKey | JBRNMXJXXCHOBR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-hydroxybutyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxybutyl)phenol?
The IUPAC name of 3-(4-hydroxybutyl)phenol (CID 19991537) is 3-(4-hydroxybutyl)phenol.
What is the SMILES notation for 3-(4-hydroxybutyl)phenol?
The canonical SMILES for 3-(4-hydroxybutyl)phenol is OCCCCc1cccc(O)c1.
What is the InChIKey of 3-(4-hydroxybutyl)phenol?
The InChIKey is JBRNMXJXXCHOBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c11-7-2-1-4-9-5-3-6-10(12)8-9/h3,5-6,8,11-12H,1-2,4,7H2.
What are the key properties of 3-(4-hydroxybutyl)phenol?
3-(4-hydroxybutyl)phenol has a molecular weight of 166.22 g/mol, XLogP of 1.71, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxybutyl)phenol is sourced from PubChem (CID 19991537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).