About 3-(4-iodobutyl)phenol
3-(4-iodobutyl)phenol (PubChem CID 174588102) has the molecular formula C10H13IO
and a molecular weight of 276.12 g/mol. Its IUPAC name is 3-(4-iodobutyl)phenol.
Molecular Properties
| Compound Name | 3-(4-iodobutyl)phenol |
| PubChem CID | 174588102 |
| Molecular Formula | C10H13IO |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 3-(4-iodobutyl)phenol |
| SMILES | Oc1cccc(CCCCI)c1 |
| InChI | InChI=1S/C10H13IO/c11-7-2-1-4-9-5-3-6-10(12)8-9/h3,5-6,8,12H,1-2,4,7H2 |
| InChIKey | ISDVZLDANNCBMM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-iodobutyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-iodobutyl)phenol?
The IUPAC name of 3-(4-iodobutyl)phenol (CID 174588102) is 3-(4-iodobutyl)phenol.
What is the SMILES notation for 3-(4-iodobutyl)phenol?
The canonical SMILES for 3-(4-iodobutyl)phenol is Oc1cccc(CCCCI)c1.
What is the InChIKey of 3-(4-iodobutyl)phenol?
The InChIKey is ISDVZLDANNCBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IO/c11-7-2-1-4-9-5-3-6-10(12)8-9/h3,5-6,8,12H,1-2,4,7H2.
What are the key properties of 3-(4-iodobutyl)phenol?
3-(4-iodobutyl)phenol has a molecular weight of 276.12 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-iodobutyl)phenol is sourced from PubChem (CID 174588102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).