C8H8O4 — CID 10583219
5-hydroxy-2-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 10583219) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 5-hydroxy-2-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-hydroxy-2-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10583219 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 5-hydroxy-2-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(C)C(=O)C(O)=CC1=O |
| InChI | InChI=1S/C8H8O4/c1-4-7(11)5(9)3-6(10)8(4)12-2/h3,9H,1-2H3 |
| InChIKey | NYYRKFLYEIGIDD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|