C10H8O4 — CID 101080716
4,5,7-trihydroxy-1H-naphthalen-2-one (PubChem CID 101080716) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 4,5,7-trihydroxy-1H-naphthalen-2-one.
| Compound Name | 4,5,7-trihydroxy-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 101080716 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 4,5,7-trihydroxy-1H-naphthalen-2-one |
| SMILES | O=C1C=C(O)c2c(O)cc(O)cc2C1 |
| InChI | InChI=1S/C10H8O4/c11-6-1-5-2-7(12)4-9(14)10(5)8(13)3-6/h1,3-4,11,13-14H,2H2 |
| InChIKey | PUIOWUWQRFTDGB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |