C19H22O5 — CID 163037258
17,19-dihydroxy-4-methyl-7-oxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione (PubChem CID 163037258) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 17,19-dihydroxy-4-methyl-7-oxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione.
| Compound Name | 17,19-dihydroxy-4-methyl-7-oxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
|---|---|
| PubChem CID | 163037258 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 17,19-dihydroxy-4-methyl-7-oxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
| SMILES | CC1CC(=O)c2c(O)cc(O)cc2CC(=O)C=CCCC2OC2C1 |
| InChI | InChI=1S/C19H22O5/c1-11-6-15(22)19-12(9-14(21)10-16(19)23)8-13(20)4-2-3-5-17-18(7-11)24-17/h2,4,9-11,17-18,21,23H,3,5-8H2,1H3 |
| InChIKey | GHCYBMDBDBNRCM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|