C23H21NO6 — CID 143627500
(4R,11E)-19-hydroxy-17-nitroso-4-phenyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione (PubChem CID 143627500) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is (4R,11E)-19-hydroxy-17-nitroso-4-phenyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione.
| Compound Name | (4R,11E)-19-hydroxy-17-nitroso-4-phenyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
|---|---|
| PubChem CID | 143627500 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (4R,11E)-19-hydroxy-17-nitroso-4-phenyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
| SMILES | O=Nc1cc(O)c2c(c1)CC(=O)/C=C/CCC1OC1C[C@H](c1ccccc1)OC2=O |
| InChI | InChI=1S/C23H21NO6/c25-17-8-4-5-9-19-21(29-19)13-20(14-6-2-1-3-7-14)30-23(27)22-15(11-17)10-16(24-28)12-18(22)26/h1-4,6-8,10,12,19-21,26H,5,9,11,13H2/b8-4+/t19?,20-,21?/m1/s1 |
| InChIKey | QYJZPZTUAVHHAN-HTHCSUFISA-N |
| XLogP | 4.31 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|