C19H24O4 — CID 162950126
(4R)-16,18-dihydroxy-4-methylbicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,12-dione (PubChem CID 162950126) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (4R)-16,18-dihydroxy-4-methylbicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,12-dione.
| Compound Name | (4R)-16,18-dihydroxy-4-methylbicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,12-dione |
|---|---|
| PubChem CID | 162950126 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (4R)-16,18-dihydroxy-4-methylbicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,12-dione |
| SMILES | C[C@@H]1CC=CCCCCC(=O)Cc2cc(O)cc(O)c2C(=O)C1 |
| InChI | InChI=1S/C19H24O4/c1-13-7-5-3-2-4-6-8-15(20)10-14-11-16(21)12-18(23)19(14)17(22)9-13/h3,5,11-13,21,23H,2,4,6-10H2,1H3/t13-/m1/s1 |
| InChIKey | RBWZLRHPBFGBPU-CYBMUJFWSA-N |
| XLogP | 3.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|