C20H8I2O8 — CID 130383929
5-(2,8-dihydroxy-4-iodo-5,6-dioxonaphthalen-1-yl)-4,6-dihydroxy-8-iodonaphthalene-1,2-dione (PubChem CID 130383929) has the molecular formula C20H8I2O8 and a molecular weight of 630.08 g/mol. Its IUPAC name is 5-(2,8-dihydroxy-4-iodo-5,6-dioxonaphthalen-1-yl)-4,6-dihydroxy-8-iodonaphthalene-1,2-dione.
| Compound Name | 5-(2,8-dihydroxy-4-iodo-5,6-dioxonaphthalen-1-yl)-4,6-dihydroxy-8-iodonaphthalene-1,2-dione |
|---|---|
| PubChem CID | 130383929 |
| Molecular Formula | C20H8I2O8 |
| Molecular Weight | 630.08 g/mol |
| Exact Mass | 629.83 |
| IUPAC Name | 5-(2,8-dihydroxy-4-iodo-5,6-dioxonaphthalen-1-yl)-4,6-dihydroxy-8-iodonaphthalene-1,2-dione |
| SMILES | O=C1C=C(O)c2c(c(I)cc(O)c2-c2c(O)cc(I)c3c2C(O)=CC(=O)C3=O)C1=O |
| InChI | InChI=1S/C20H8I2O8/c21-5-1-7(23)17(15-9(25)3-11(27)19(29)13(5)15)18-8(24)2-6(22)14-16(18)10(26)4-12(28)20(14)30/h1-4,23-26H |
| InChIKey | VPIZNPFCBUFANQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.08 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|