C24H18O8 — CID 634823
2-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 634823) has the molecular formula C24H18O8 and a molecular weight of 434.40 g/mol. Its IUPAC name is 2-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 2-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 634823 |
| Molecular Formula | C24H18O8 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 2-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | COc1ccc(OC)c2c1C(=O)C=C(C1=CC(=O)c3c(OC)ccc(OC)c3C1=O)C2=O |
| InChI | InChI=1S/C24H18O8/c1-29-15-5-7-17(31-3)21-19(15)13(25)9-11(23(21)27)12-10-14(26)20-16(30-2)6-8-18(32-4)22(20)24(12)28/h5-10H,1-4H3 |
| InChIKey | HKDVYXXPLCOAMF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|