C14H14O4S — CID 57410783
2-ethylsulfanyl-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 57410783) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-ethylsulfanyl-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 2-ethylsulfanyl-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 57410783 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-ethylsulfanyl-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCSC1=CC(=O)c2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C14H14O4S/c1-4-19-11-7-8(15)12-9(17-2)5-6-10(18-3)13(12)14(11)16/h5-7H,4H2,1-3H3 |
| InChIKey | RHIWARQBGGGZKA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|