C16H16O5S — CID 58055871
5,8-dimethoxy-2-[methylidene(2-oxopropyl)-λ4-sulfanyl]naphthalene-1,4-dione (PubChem CID 58055871) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 5,8-dimethoxy-2-[methylidene(2-oxopropyl)-λ4-sulfanyl]naphthalene-1,4-dione.
| Compound Name | 5,8-dimethoxy-2-[methylidene(2-oxopropyl)-λ4-sulfanyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 58055871 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 5,8-dimethoxy-2-[methylidene(2-oxopropyl)-λ4-sulfanyl]naphthalene-1,4-dione |
| SMILES | C=S(CC(C)=O)C1=CC(=O)c2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C16H16O5S/c1-9(17)8-22(4)13-7-10(18)14-11(20-2)5-6-12(21-3)15(14)16(13)19/h5-7H,4,8H2,1-3H3 |
| InChIKey | YPXFDOWFPDGRAO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|