C15H16O5S — CID 142711894
2-(2-hydroxypropylsulfanyl)-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 142711894) has the molecular formula C15H16O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-(2-hydroxypropylsulfanyl)-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 2-(2-hydroxypropylsulfanyl)-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 142711894 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-(2-hydroxypropylsulfanyl)-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | COc1ccc(OC)c2c1C(=O)C=C(SCC(C)O)C2=O |
| InChI | InChI=1S/C15H16O5S/c1-8(16)7-21-12-6-9(17)13-10(19-2)4-5-11(20-3)14(13)15(12)18/h4-6,8,16H,7H2,1-3H3 |
| InChIKey | XLNWJIHGCGKHDF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|