C19H24O5 — CID 10688014
5,8-dimethoxy-2-(1-methoxy-4-methylpentyl)naphthalene-1,4-dione (PubChem CID 10688014) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5,8-dimethoxy-2-(1-methoxy-4-methylpentyl)naphthalene-1,4-dione.
| Compound Name | 5,8-dimethoxy-2-(1-methoxy-4-methylpentyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 10688014 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5,8-dimethoxy-2-(1-methoxy-4-methylpentyl)naphthalene-1,4-dione |
| SMILES | COc1ccc(OC)c2c1C(=O)C=C(C(CCC(C)C)OC)C2=O |
| InChI | InChI=1S/C19H24O5/c1-11(2)6-7-14(22-3)12-10-13(20)17-15(23-4)8-9-16(24-5)18(17)19(12)21/h8-11,14H,6-7H2,1-5H3 |
| InChIKey | KBOAERBRIILXSR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|