C15H16O4S — CID 175116593
5,8-dimethoxy-2-propan-2-yl-3-sulfanylnaphthalene-1,4-dione (PubChem CID 175116593) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is 5,8-dimethoxy-2-propan-2-yl-3-sulfanylnaphthalene-1,4-dione.
| Compound Name | 5,8-dimethoxy-2-propan-2-yl-3-sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 175116593 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5,8-dimethoxy-2-propan-2-yl-3-sulfanylnaphthalene-1,4-dione |
| SMILES | COc1ccc(OC)c2c1C(=O)C(S)=C(C(C)C)C2=O |
| InChI | InChI=1S/C15H16O4S/c1-7(2)10-13(16)11-8(18-3)5-6-9(19-4)12(11)14(17)15(10)20/h5-7,20H,1-4H3 |
| InChIKey | KGPAJZYOIZMXCV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|