C13H11BrO4 — CID 628531
2-bromo-5,8-dimethoxy-3-methylnaphthalene-1,4-dione (PubChem CID 628531) has the molecular formula C13H11BrO4 and a molecular weight of 311.13 g/mol. Its IUPAC name is 2-bromo-5,8-dimethoxy-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-bromo-5,8-dimethoxy-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 628531 |
| Molecular Formula | C13H11BrO4 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 2-bromo-5,8-dimethoxy-3-methylnaphthalene-1,4-dione |
| SMILES | COc1ccc(OC)c2c1C(=O)C(C)=C(Br)C2=O |
| InChI | InChI=1S/C13H11BrO4/c1-6-11(14)13(16)10-8(18-3)5-4-7(17-2)9(10)12(6)15/h4-5H,1-3H3 |
| InChIKey | KAPQIOFPLHEULS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|