C12H8Br2O4 — CID 633173
3,6-dibromo-8-hydroxy-5-methoxy-2-methylnaphthalene-1,4-dione (PubChem CID 633173) has the molecular formula C12H8Br2O4 and a molecular weight of 376.00 g/mol. Its IUPAC name is 3,6-dibromo-8-hydroxy-5-methoxy-2-methylnaphthalene-1,4-dione.
| Compound Name | 3,6-dibromo-8-hydroxy-5-methoxy-2-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 633173 |
| Molecular Formula | C12H8Br2O4 |
| Molecular Weight | 376.00 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | 3,6-dibromo-8-hydroxy-5-methoxy-2-methylnaphthalene-1,4-dione |
| SMILES | COc1c(Br)cc(O)c2c1C(=O)C(Br)=C(C)C2=O |
| InChI | InChI=1S/C12H8Br2O4/c1-4-9(14)11(17)8-7(10(4)16)6(15)3-5(13)12(8)18-2/h3,15H,1-2H3 |
| InChIKey | RLUUQPJVDGERMB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.00 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|