C14H13BrO5 — CID 12041026
3-bromo-5-hydroxy-7-(methoxymethoxy)-2,6-dimethylnaphthalene-1,4-dione (PubChem CID 12041026) has the molecular formula C14H13BrO5 and a molecular weight of 341.16 g/mol. Its IUPAC name is 3-bromo-5-hydroxy-7-(methoxymethoxy)-2,6-dimethylnaphthalene-1,4-dione.
| Compound Name | 3-bromo-5-hydroxy-7-(methoxymethoxy)-2,6-dimethylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 12041026 |
| Molecular Formula | C14H13BrO5 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 3-bromo-5-hydroxy-7-(methoxymethoxy)-2,6-dimethylnaphthalene-1,4-dione |
| SMILES | COCOc1cc2c(c(O)c1C)C(=O)C(Br)=C(C)C2=O |
| InChI | InChI=1S/C14H13BrO5/c1-6-9(20-5-19-3)4-8-10(13(6)17)14(18)11(15)7(2)12(8)16/h4,17H,5H2,1-3H3 |
| InChIKey | WBCKOVHIWJFVGF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|