C22H18O6 — CID 11749261
1-hydroxy-8-methoxy-11-(methoxymethoxy)-3-methylbenzo[a]anthracene-7,12-dione (PubChem CID 11749261) has the molecular formula C22H18O6 and a molecular weight of 378.38 g/mol. Its IUPAC name is 1-hydroxy-8-methoxy-11-(methoxymethoxy)-3-methylbenzo[a]anthracene-7,12-dione.
| Compound Name | 1-hydroxy-8-methoxy-11-(methoxymethoxy)-3-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 11749261 |
| Molecular Formula | C22H18O6 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-hydroxy-8-methoxy-11-(methoxymethoxy)-3-methylbenzo[a]anthracene-7,12-dione |
| SMILES | COCOc1ccc(OC)c2c1C(=O)c1c(ccc3cc(C)cc(O)c13)C2=O |
| InChI | InChI=1S/C22H18O6/c1-11-8-12-4-5-13-18(17(12)14(23)9-11)22(25)20-16(28-10-26-2)7-6-15(27-3)19(20)21(13)24/h4-9,23H,10H2,1-3H3 |
| InChIKey | OAYBRIDJPHXUJY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|