C19H14O5 — CID 141413725
4,5,10-trihydroxy-9-methoxy-2-methylbenzo[a]fluoren-11-one (PubChem CID 141413725) has the molecular formula C19H14O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is 4,5,10-trihydroxy-9-methoxy-2-methylbenzo[a]fluoren-11-one.
| Compound Name | 4,5,10-trihydroxy-9-methoxy-2-methylbenzo[a]fluoren-11-one |
|---|---|
| PubChem CID | 141413725 |
| Molecular Formula | C19H14O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4,5,10-trihydroxy-9-methoxy-2-methylbenzo[a]fluoren-11-one |
| SMILES | COc1ccc2c(c1O)C(=O)c1c-2cc(O)c2c(O)cc(C)cc12 |
| InChI | InChI=1S/C19H14O5/c1-8-5-11-15-10(7-13(21)16(11)12(20)6-8)9-3-4-14(24-2)18(22)17(9)19(15)23/h3-7,20-22H,1-2H3 |
| InChIKey | DFZJNDZJPUWKLJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |