C21H22O3 — CID 11666936
5,8-dimethoxy-2-(2,4,6-trimethylphenyl)naphthalen-1-ol (PubChem CID 11666936) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 5,8-dimethoxy-2-(2,4,6-trimethylphenyl)naphthalen-1-ol.
| Compound Name | 5,8-dimethoxy-2-(2,4,6-trimethylphenyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 11666936 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 5,8-dimethoxy-2-(2,4,6-trimethylphenyl)naphthalen-1-ol |
| SMILES | COc1ccc(OC)c2c(O)c(-c3c(C)cc(C)cc3C)ccc12 |
| InChI | InChI=1S/C21H22O3/c1-12-10-13(2)19(14(3)11-12)16-7-6-15-17(23-4)8-9-18(24-5)20(15)21(16)22/h6-11,22H,1-5H3 |
| InChIKey | JVIUMVZSFZMNDB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |