C26H24O8 — CID 139590638
9-[(2R,4R,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]-1,8-dihydroxy-5-methoxy-3-methylbenzo[a]anthracene-7,12-dione (PubChem CID 139590638) has the molecular formula C26H24O8 and a molecular weight of 464.47 g/mol. Its IUPAC name is 9-[(2R,4R,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]-1,8-dihydroxy-5-methoxy-3-methylbenzo[a]anthracene-7,12-dione.
| Compound Name | 9-[(2R,4R,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]-1,8-dihydroxy-5-methoxy-3-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 139590638 |
| Molecular Formula | C26H24O8 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 9-[(2R,4R,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]-1,8-dihydroxy-5-methoxy-3-methylbenzo[a]anthracene-7,12-dione |
| SMILES | COc1cc2c(c3c(O)cc(C)cc13)C(=O)c1ccc([C@H]3C[C@@H](O)[C@H](O)[C@@H](C)O3)c(O)c1C2=O |
| InChI | InChI=1S/C26H24O8/c1-10-6-14-18(33-3)8-15-21(20(14)16(27)7-10)25(31)13-5-4-12(24(30)22(13)26(15)32)19-9-17(28)23(29)11(2)34-19/h4-8,11,17,19,23,27-30H,9H2,1-3H3/t11-,17-,19-,23-/m1/s1 |
| InChIKey | NDLLZHNWFWEGGG-CCARIGQNSA-N |
| XLogP | 2.92 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'} |
|---|