C31H28O10 — CID 163195305
9-[(1R,5R,10R,11R,13S)-5,11-dimethyl-6-oxo-2,4,9,12-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]-1,5,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione (PubChem CID 163195305) has the molecular formula C31H28O10 and a molecular weight of 560.56 g/mol. Its IUPAC name is 9-[(1R,5R,10R,11R,13S)-5,11-dimethyl-6-oxo-2,4,9,12-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]-1,5,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione.
| Compound Name | 9-[(1R,5R,10R,11R,13S)-5,11-dimethyl-6-oxo-2,4,9,12-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]-1,5,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 163195305 |
| Molecular Formula | C31H28O10 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 9-[(1R,5R,10R,11R,13S)-5,11-dimethyl-6-oxo-2,4,9,12-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]-1,5,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione |
| SMILES | Cc1cc(O)c2c3c(cc(O)c2c1)C(=O)c1c(ccc([C@@H]2C[C@H]4OC5O[C@H](C)C(=O)CC5O[C@@H]4[C@@H](C)O2)c1O)C3=O |
| InChI | InChI=1S/C31H28O10/c1-11-6-16-19(33)8-17-25(24(16)20(34)7-11)28(36)15-5-4-14(27(35)26(15)29(17)37)21-10-22-30(13(3)38-21)40-23-9-18(32)12(2)39-31(23)41-22/h4-8,12-13,21-23,30-31,33-35H,9-10H2,1-3H3/t12-,13-,21+,22-,23?,30-,31?/m1/s1 |
| InChIKey | UAKCZICSIKJWDB-MEAGLVDUSA-N |
| XLogP | 3.75 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'} |
|---|