C27H27NO6 — CID 163061758
9-[5-(dimethylamino)-6-methyloxan-2-yl]-1,5,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione (PubChem CID 163061758) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is 9-[5-(dimethylamino)-6-methyloxan-2-yl]-1,5,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione.
| Compound Name | 9-[5-(dimethylamino)-6-methyloxan-2-yl]-1,5,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 163061758 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 9-[5-(dimethylamino)-6-methyloxan-2-yl]-1,5,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione |
| SMILES | Cc1cc(O)c2c3c(cc(O)c2c1)C(=O)c1c(ccc(C2CCC(N(C)C)C(C)O2)c1O)C3=O |
| InChI | InChI=1S/C27H27NO6/c1-12-9-16-19(29)11-17-23(22(16)20(30)10-12)26(32)15-6-5-14(25(31)24(15)27(17)33)21-8-7-18(28(3)4)13(2)34-21/h5-6,9-11,13,18,21,29-31H,7-8H2,1-4H3 |
| InChIKey | LCNXLRHNCJLJRN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'} |
|---|