C22H22O10 — CID 162938382
1,5-dihydroxy-8-methoxy-2-methyl-3-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione (PubChem CID 162938382) has the molecular formula C22H22O10 and a molecular weight of 446.41 g/mol. Its IUPAC name is 1,5-dihydroxy-8-methoxy-2-methyl-3-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione.
| Compound Name | 1,5-dihydroxy-8-methoxy-2-methyl-3-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 162938382 |
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 1,5-dihydroxy-8-methoxy-2-methyl-3-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione |
| SMILES | COc1ccc(O)c2c1C(=O)c1c(cc(O[C@H]3O[C@@H](C)[C@H](O)[C@H](O)[C@@H]3O)c(C)c1O)C2=O |
| InChI | InChI=1S/C22H22O10/c1-7-12(32-22-21(29)20(28)17(25)8(2)31-22)6-9-13(16(7)24)19(27)15-11(30-3)5-4-10(23)14(15)18(9)26/h4-6,8,17,20-25,28-29H,1-3H3/t8-,17-,20-,21-,22+/m0/s1 |
| InChIKey | MVQWQYZBXXKWHD-BNNLEZKSSA-N |
| XLogP | 0.40 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|