C33H30O10 — CID 162913258
[1-(3,4-dihydronaphthalen-2-yl)-5-hydroxy-6-methyl-9,10-dioxo-7-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate (PubChem CID 162913258) has the molecular formula C33H30O10 and a molecular weight of 586.59 g/mol. Its IUPAC name is [1-(3,4-dihydronaphthalen-2-yl)-5-hydroxy-6-methyl-9,10-dioxo-7-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate.
| Compound Name | [1-(3,4-dihydronaphthalen-2-yl)-5-hydroxy-6-methyl-9,10-dioxo-7-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162913258 |
| Molecular Formula | C33H30O10 |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | [1-(3,4-dihydronaphthalen-2-yl)-5-hydroxy-6-methyl-9,10-dioxo-7-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1C1=Cc3ccccc3CC1)C(=O)c1cc(O[C@@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]3O)c(C)c(O)c1C2=O |
| InChI | InChI=1S/C33H30O10/c1-14-23(43-33-32(40)31(39)28(36)15(2)41-33)13-21-26(27(14)35)29(37)20-10-11-22(42-16(3)34)24(25(20)30(21)38)19-9-8-17-6-4-5-7-18(17)12-19/h4-7,10-13,15,28,31-33,35-36,39-40H,8-9H2,1-3H3/t15-,28+,31+,32+,33-/m0/s1 |
| InChIKey | IERPQKAYIAPWQY-KFSUFBMOSA-N |
| XLogP | 3.09 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|