C41H40O12 — CID 162831911
[5-hydroxy-6-[[3-(hydroxymethyl)phenyl]methyl]-1-[2-[3-(3-hydroxypropyl)phenyl]ethenyl]-9,10-dioxo-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate (PubChem CID 162831911) has the molecular formula C41H40O12 and a molecular weight of 724.76 g/mol. Its IUPAC name is [5-hydroxy-6-[[3-(hydroxymethyl)phenyl]methyl]-1-[2-[3-(3-hydroxypropyl)phenyl]ethenyl]-9,10-dioxo-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate.
| Compound Name | [5-hydroxy-6-[[3-(hydroxymethyl)phenyl]methyl]-1-[2-[3-(3-hydroxypropyl)phenyl]ethenyl]-9,10-dioxo-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162831911 |
| Molecular Formula | C41H40O12 |
| Molecular Weight | 724.76 g/mol |
| Exact Mass | 724.25 |
| IUPAC Name | [5-hydroxy-6-[[3-(hydroxymethyl)phenyl]methyl]-1-[2-[3-(3-hydroxypropyl)phenyl]ethenyl]-9,10-dioxo-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1C=Cc1cccc(CCCO)c1)C(=O)c1cc(OC3OC(C)C(O)C(O)C3O)c(Cc3cccc(CO)c3)c(O)c1C2=O |
| InChI | InChI=1S/C41H40O12/c1-21-35(45)39(49)40(50)41(51-21)53-32-19-30-34(37(47)29(32)18-25-8-4-9-26(17-25)20-43)36(46)28-13-14-31(52-22(2)44)27(33(28)38(30)48)12-11-24-7-3-6-23(16-24)10-5-15-42/h3-4,6-9,11-14,16-17,19,21,35,39-43,45,47,49-50H,5,10,15,18,20H2,1-2H3 |
| InChIKey | RLUCCEXGDMLYRW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|