C34H34O12 — CID 162835627
[5-hydroxy-1-[(E)-2-[3-(2-hydroxyethyl)phenyl]ethenyl]-4-(hydroxymethyl)-6-methyl-9,10-dioxo-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate (PubChem CID 162835627) has the molecular formula C34H34O12 and a molecular weight of 634.63 g/mol. Its IUPAC name is [5-hydroxy-1-[(E)-2-[3-(2-hydroxyethyl)phenyl]ethenyl]-4-(hydroxymethyl)-6-methyl-9,10-dioxo-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate.
| Compound Name | [5-hydroxy-1-[(E)-2-[3-(2-hydroxyethyl)phenyl]ethenyl]-4-(hydroxymethyl)-6-methyl-9,10-dioxo-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162835627 |
| Molecular Formula | C34H34O12 |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | [5-hydroxy-1-[(E)-2-[3-(2-hydroxyethyl)phenyl]ethenyl]-4-(hydroxymethyl)-6-methyl-9,10-dioxo-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc(CO)c2c(c1/C=C/c1cccc(CCO)c1)C(=O)c1cc(O[C@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]3O)c(C)c(O)c1C2=O |
| InChI | InChI=1S/C34H34O12/c1-15-23(46-34-33(43)32(42)29(39)16(2)44-34)13-22-27(28(15)38)31(41)25-20(14-36)12-24(45-17(3)37)21(26(25)30(22)40)8-7-18-5-4-6-19(11-18)9-10-35/h4-8,11-13,16,29,32-36,38-39,42-43H,9-10,14H2,1-3H3/b8-7+/t16-,29+,32+,33+,34+/m0/s1 |
| InChIKey | GKWMEQQNLQKTNT-LKEOIBOOSA-N |
| XLogP | 1.81 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|