C39H36O10 — CID 162826547
[5-hydroxy-9,10-dioxo-1-[(E)-2-phenylethenyl]-6-(3-phenylpropyl)-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate (PubChem CID 162826547) has the molecular formula C39H36O10 and a molecular weight of 664.71 g/mol. Its IUPAC name is [5-hydroxy-9,10-dioxo-1-[(E)-2-phenylethenyl]-6-(3-phenylpropyl)-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate.
| Compound Name | [5-hydroxy-9,10-dioxo-1-[(E)-2-phenylethenyl]-6-(3-phenylpropyl)-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162826547 |
| Molecular Formula | C39H36O10 |
| Molecular Weight | 664.71 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | [5-hydroxy-9,10-dioxo-1-[(E)-2-phenylethenyl]-6-(3-phenylpropyl)-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1/C=C/c1ccccc1)C(=O)c1cc(O[C@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]3O)c(CCCc3ccccc3)c(O)c1C2=O |
| InChI | InChI=1S/C39H36O10/c1-21-33(41)37(45)38(46)39(47-21)49-30-20-28-32(34(42)26(30)15-9-14-23-10-5-3-6-11-23)35(43)27-18-19-29(48-22(2)40)25(31(27)36(28)44)17-16-24-12-7-4-8-13-24/h3-8,10-13,16-21,33,37-39,41-42,45-46H,9,14-15H2,1-2H3/b17-16+/t21-,33+,37+,38+,39+/m0/s1 |
| InChIKey | IWXNRENBYFHNIK-XHGAJZRVSA-N |
| XLogP | 4.64 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|