C36H36O10 — CID 162834314
[6-cyclohexyl-5-hydroxy-9,10-dioxo-1-[(E)-2-phenylethenyl]-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate (PubChem CID 162834314) has the molecular formula C36H36O10 and a molecular weight of 628.67 g/mol. Its IUPAC name is [6-cyclohexyl-5-hydroxy-9,10-dioxo-1-[(E)-2-phenylethenyl]-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate.
| Compound Name | [6-cyclohexyl-5-hydroxy-9,10-dioxo-1-[(E)-2-phenylethenyl]-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162834314 |
| Molecular Formula | C36H36O10 |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | [6-cyclohexyl-5-hydroxy-9,10-dioxo-1-[(E)-2-phenylethenyl]-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1/C=C/c1ccccc1)C(=O)c1cc(O[C@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]3O)c(C3CCCCC3)c(O)c1C2=O |
| InChI | InChI=1S/C36H36O10/c1-18-30(38)34(42)35(43)36(44-18)46-26-17-24-29(33(41)27(26)21-11-7-4-8-12-21)31(39)23-15-16-25(45-19(2)37)22(28(23)32(24)40)14-13-20-9-5-3-6-10-20/h3,5-6,9-10,13-18,21,30,34-36,38,41-43H,4,7-8,11-12H2,1-2H3/b14-13+/t18-,30+,34+,35+,36+/m0/s1 |
| InChIKey | IDNPPIPFPZALCT-CASJBDPCSA-N |
| XLogP | 4.52 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|