C35H35NO10 — CID 162832496
[5-hydroxy-9,10-dioxo-1-(2-phenylethenyl)-6-piperidin-4-yl-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate (PubChem CID 162832496) has the molecular formula C35H35NO10 and a molecular weight of 629.66 g/mol. Its IUPAC name is [5-hydroxy-9,10-dioxo-1-(2-phenylethenyl)-6-piperidin-4-yl-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate.
| Compound Name | [5-hydroxy-9,10-dioxo-1-(2-phenylethenyl)-6-piperidin-4-yl-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162832496 |
| Molecular Formula | C35H35NO10 |
| Molecular Weight | 629.66 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | [5-hydroxy-9,10-dioxo-1-(2-phenylethenyl)-6-piperidin-4-yl-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1C=Cc1ccccc1)C(=O)c1cc(OC3OC(C)C(O)C(O)C3O)c(C3CCNCC3)c(O)c1C2=O |
| InChI | InChI=1S/C35H35NO10/c1-17-29(38)33(42)34(43)35(44-17)46-25-16-23-28(32(41)26(25)20-12-14-36-15-13-20)30(39)22-10-11-24(45-18(2)37)21(27(22)31(23)40)9-8-19-6-4-3-5-7-19/h3-11,16-17,20,29,33-36,38,41-43H,12-15H2,1-2H3 |
| InChIKey | GSAVZHYJTIXOFG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|