C27H29NO10 — CID 162966951
[5-hydroxy-9,10-dioxo-6-piperidin-4-yl-7-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate (PubChem CID 162966951) has the molecular formula C27H29NO10 and a molecular weight of 527.53 g/mol. Its IUPAC name is [5-hydroxy-9,10-dioxo-6-piperidin-4-yl-7-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate.
| Compound Name | [5-hydroxy-9,10-dioxo-6-piperidin-4-yl-7-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162966951 |
| Molecular Formula | C27H29NO10 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | [5-hydroxy-9,10-dioxo-6-piperidin-4-yl-7-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C(=O)c1cc(O[C@H]3O[C@H](C)[C@@H](O)[C@@H](O)[C@H]3O)c(C3CCNCC3)c(O)c1C2=O |
| InChI | InChI=1S/C27H29NO10/c1-11-21(30)25(34)26(35)27(36-11)38-18-10-17-20(24(33)19(18)13-5-7-28-8-6-13)23(32)15-4-3-14(37-12(2)29)9-16(15)22(17)31/h3-4,9-11,13,21,25-28,30,33-35H,5-8H2,1-2H3/t11-,21-,25-,26-,27-/m1/s1 |
| InChIKey | XNSGZADXNXEWHT-AVRBSMPGSA-N |
| XLogP | 0.77 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|