C35H33NO11 — CID 163116744
[5-hydroxy-6-[[3-(hydroxymethyl)phenyl]methyl]-9,10-dioxo-8-(2H-pyrrol-4-ylmethyl)-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate (PubChem CID 163116744) has the molecular formula C35H33NO11 and a molecular weight of 643.65 g/mol. Its IUPAC name is [5-hydroxy-6-[[3-(hydroxymethyl)phenyl]methyl]-9,10-dioxo-8-(2H-pyrrol-4-ylmethyl)-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate.
| Compound Name | [5-hydroxy-6-[[3-(hydroxymethyl)phenyl]methyl]-9,10-dioxo-8-(2H-pyrrol-4-ylmethyl)-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 163116744 |
| Molecular Formula | C35H33NO11 |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | [5-hydroxy-6-[[3-(hydroxymethyl)phenyl]methyl]-9,10-dioxo-8-(2H-pyrrol-4-ylmethyl)-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C(=O)c1c(CC3=CCN=C3)c(O[C@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]3O)c(Cc3cccc(CO)c3)c(O)c1C2=O |
| InChI | InChI=1S/C35H33NO11/c1-16-28(39)32(43)33(44)35(45-16)47-34-24(12-19-8-9-36-14-19)26-27(31(42)25(34)11-18-4-3-5-20(10-18)15-37)29(40)22-7-6-21(46-17(2)38)13-23(22)30(26)41/h3-8,10,13-14,16,28,32-33,35,37,39,42-44H,9,11-12,15H2,1-2H3/t16-,28+,32+,33+,35+/m0/s1 |
| InChIKey | ABUYQPTVVAVPLH-YTDXHPFCSA-N |
| XLogP | 1.94 |
| TPSA | 192.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|