C20H18O5 — CID 139070877
(1R,3R)-1,11-dihydroxy-8-methoxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione (PubChem CID 139070877) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (1R,3R)-1,11-dihydroxy-8-methoxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione.
| Compound Name | (1R,3R)-1,11-dihydroxy-8-methoxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 139070877 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (1R,3R)-1,11-dihydroxy-8-methoxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione |
| SMILES | COc1ccc(O)c2c1C(=O)c1ccc3c(c1C2=O)[C@H](O)C[C@H](C)C3 |
| InChI | InChI=1S/C20H18O5/c1-9-7-10-3-4-11-16(15(10)13(22)8-9)20(24)17-12(21)5-6-14(25-2)18(17)19(11)23/h3-6,9,13,21-22H,7-8H2,1-2H3/t9-,13-/m1/s1 |
| InChIKey | CAEGIOZCLWNLAP-NOZJJQNGSA-N |
| XLogP | 2.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|