C20H18O6 — CID 174344250
6,8,10,11-tetrahydroxy-1-methoxy-12-methylidene-7,8,9,10-tetrahydrotetracen-5-one (PubChem CID 174344250) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 6,8,10,11-tetrahydroxy-1-methoxy-12-methylidene-7,8,9,10-tetrahydrotetracen-5-one.
| Compound Name | 6,8,10,11-tetrahydroxy-1-methoxy-12-methylidene-7,8,9,10-tetrahydrotetracen-5-one |
|---|---|
| PubChem CID | 174344250 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 6,8,10,11-tetrahydroxy-1-methoxy-12-methylidene-7,8,9,10-tetrahydrotetracen-5-one |
| SMILES | C=C1c2c(OC)cccc2C(=O)c2c(O)c3c(c(O)c21)C(O)CC(O)C3 |
| InChI | InChI=1S/C20H18O6/c1-8-14-10(4-3-5-13(14)26-2)18(23)17-15(8)20(25)16-11(19(17)24)6-9(21)7-12(16)22/h3-5,9,12,21-22,24-25H,1,6-7H2,2H3 |
| InChIKey | AUUNEIXKHAMPEV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|