C20H13F3O9S — CID 143192885
(8-formyl-6,10,11-trihydroxy-5,12-dioxo-7,8,9,10-tetrahydrotetracen-1-yl) trifluoromethanesulfonate (PubChem CID 143192885) has the molecular formula C20H13F3O9S and a molecular weight of 486.38 g/mol. Its IUPAC name is (8-formyl-6,10,11-trihydroxy-5,12-dioxo-7,8,9,10-tetrahydrotetracen-1-yl) trifluoromethanesulfonate.
| Compound Name | (8-formyl-6,10,11-trihydroxy-5,12-dioxo-7,8,9,10-tetrahydrotetracen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143192885 |
| Molecular Formula | C20H13F3O9S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | (8-formyl-6,10,11-trihydroxy-5,12-dioxo-7,8,9,10-tetrahydrotetracen-1-yl) trifluoromethanesulfonate |
| SMILES | O=CC1Cc2c(O)c3c(c(O)c2C(O)C1)C(=O)c1c(OS(=O)(=O)C(F)(F)F)cccc1C3=O |
| InChI | InChI=1S/C20H13F3O9S/c21-20(22,23)33(30,31)32-11-3-1-2-8-13(11)19(29)15-14(16(8)26)17(27)9-4-7(6-24)5-10(25)12(9)18(15)28/h1-3,6-7,10,25,27-28H,4-5H2 |
| InChIKey | QTPWIFWEGNPKQF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|