C21H19NO9 — CID 171065001
4'-(aminooxymethyl)-6,7,11-trihydroxy-4-methoxyspiro[8,10-dihydro-7H-tetracene-9,3'-dioxetane]-5,12-dione (PubChem CID 171065001) has the molecular formula C21H19NO9 and a molecular weight of 429.38 g/mol. Its IUPAC name is 4'-(aminooxymethyl)-6,7,11-trihydroxy-4-methoxyspiro[8,10-dihydro-7H-tetracene-9,3'-dioxetane]-5,12-dione.
| Compound Name | 4'-(aminooxymethyl)-6,7,11-trihydroxy-4-methoxyspiro[8,10-dihydro-7H-tetracene-9,3'-dioxetane]-5,12-dione |
|---|---|
| PubChem CID | 171065001 |
| Molecular Formula | C21H19NO9 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 4'-(aminooxymethyl)-6,7,11-trihydroxy-4-methoxyspiro[8,10-dihydro-7H-tetracene-9,3'-dioxetane]-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC1(CC3O)OOC1CON |
| InChI | InChI=1S/C21H19NO9/c1-28-11-4-2-3-8-14(11)20(27)16-15(17(8)24)18(25)9-5-21(12(7-29-22)30-31-21)6-10(23)13(9)19(16)26/h2-4,10,12,23,25-26H,5-7,22H2,1H3 |
| InChIKey | FESZIDHXUHBECZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|