C28H24O10 — CID 70603459
9-acetyl-6,7,9,11-tetrahydroxy-4-[(3-methoxyphenoxy)methoxy]-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 70603459) has the molecular formula C28H24O10 and a molecular weight of 520.49 g/mol. Its IUPAC name is 9-acetyl-6,7,9,11-tetrahydroxy-4-[(3-methoxyphenoxy)methoxy]-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 9-acetyl-6,7,9,11-tetrahydroxy-4-[(3-methoxyphenoxy)methoxy]-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 70603459 |
| Molecular Formula | C28H24O10 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 9-acetyl-6,7,9,11-tetrahydroxy-4-[(3-methoxyphenoxy)methoxy]-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc(OCOc2cccc3c2C(=O)c2c(O)c4c(c(O)c2C3=O)CC(O)(C(C)=O)CC4O)c1 |
| InChI | InChI=1S/C28H24O10/c1-13(29)28(35)10-17-20(18(30)11-28)26(33)23-22(25(17)32)24(31)16-7-4-8-19(21(16)27(23)34)38-12-37-15-6-3-5-14(9-15)36-2/h3-9,18,30,32-33,35H,10-12H2,1-2H3 |
| InChIKey | RLOOPCAEABBPAM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|