C27H21ClO7Se — CID 10348051
(7S,9S)-9-acetyl-7-(2-chlorophenyl)selanyl-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 10348051) has the molecular formula C27H21ClO7Se and a molecular weight of 571.87 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-7-(2-chlorophenyl)selanyl-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-7-(2-chlorophenyl)selanyl-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 10348051 |
| Molecular Formula | C27H21ClO7Se |
| Molecular Weight | 571.87 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | (7S,9S)-9-acetyl-7-(2-chlorophenyl)selanyl-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3[Se]c1ccccc1Cl |
| InChI | InChI=1S/C27H21ClO7Se/c1-12(29)27(34)10-14-20(18(11-27)36-17-9-4-3-7-15(17)28)26(33)22-21(24(14)31)23(30)13-6-5-8-16(35-2)19(13)25(22)32/h3-9,18,31,33-34H,10-11H2,1-2H3/t18-,27-/m0/s1 |
| InChIKey | FESQLRNTNIVUDZ-MYUZEXMDSA-N |
| XLogP | 2.87 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.87 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|