C27H24N2O9S — CID 101432074
N-[(Z)-1-[(2S,4S)-2,4,5,12-tetrahydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethylideneamino]benzenesulfonamide (PubChem CID 101432074) has the molecular formula C27H24N2O9S and a molecular weight of 552.56 g/mol. Its IUPAC name is N-[(Z)-1-[(2S,4S)-2,4,5,12-tetrahydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethylideneamino]benzenesulfonamide.
| Compound Name | N-[(Z)-1-[(2S,4S)-2,4,5,12-tetrahydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 101432074 |
| Molecular Formula | C27H24N2O9S |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | N-[(Z)-1-[(2S,4S)-2,4,5,12-tetrahydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethylideneamino]benzenesulfonamide |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(/C(C)=N\NS(=O)(=O)c1ccccc1)C[C@@H]3O |
| InChI | InChI=1S/C27H24N2O9S/c1-13(28-29-39(36,37)14-7-4-3-5-8-14)27(35)11-16-19(17(30)12-27)25(33)22-21(24(16)32)23(31)15-9-6-10-18(38-2)20(15)26(22)34/h3-10,17,29-30,32-33,35H,11-12H2,1-2H3/b28-13-/t17-,27-/m0/s1 |
| InChIKey | WUHCZUSGJMIZBF-ADOQYPKPSA-N |
| XLogP | 1.95 |
| TPSA | 182.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|