C24H26N2O8 — CID 166149911
2,4,5,12-tetrahydroxy-7-methoxy-N-methyl-N-[2-(methylamino)ethyl]-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxamide (PubChem CID 166149911) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2,4,5,12-tetrahydroxy-7-methoxy-N-methyl-N-[2-(methylamino)ethyl]-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxamide.
| Compound Name | 2,4,5,12-tetrahydroxy-7-methoxy-N-methyl-N-[2-(methylamino)ethyl]-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 166149911 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2,4,5,12-tetrahydroxy-7-methoxy-N-methyl-N-[2-(methylamino)ethyl]-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxamide |
| SMILES | CNCCN(C)C(=O)C1(O)Cc2c(O)c3c(c(O)c2C(O)C1)C(=O)c1c(OC)cccc1C3=O |
| InChI | InChI=1S/C24H26N2O8/c1-25-7-8-26(2)23(32)24(33)9-12-15(13(27)10-24)21(30)18-17(20(12)29)19(28)11-5-4-6-14(34-3)16(11)22(18)31/h4-6,13,25,27,29-30,33H,7-10H2,1-3H3 |
| InChIKey | TYJXFYZTJKNTIB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 156.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|