C26H25F3N2O10S — CID 54242132
6,7,9,11-tetrahydroxy-4-methoxy-9-[2-[4-(trifluoromethylsulfonyl)piperazin-1-yl]acetyl]-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 54242132) has the molecular formula C26H25F3N2O10S and a molecular weight of 614.55 g/mol. Its IUPAC name is 6,7,9,11-tetrahydroxy-4-methoxy-9-[2-[4-(trifluoromethylsulfonyl)piperazin-1-yl]acetyl]-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 6,7,9,11-tetrahydroxy-4-methoxy-9-[2-[4-(trifluoromethylsulfonyl)piperazin-1-yl]acetyl]-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 54242132 |
| Molecular Formula | C26H25F3N2O10S |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | 6,7,9,11-tetrahydroxy-4-methoxy-9-[2-[4-(trifluoromethylsulfonyl)piperazin-1-yl]acetyl]-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(=O)CN1CCN(S(=O)(=O)C(F)(F)F)CC1)CC3O |
| InChI | InChI=1S/C26H25F3N2O10S/c1-41-15-4-2-3-12-18(15)24(37)20-19(21(12)34)22(35)13-9-25(38,10-14(32)17(13)23(20)36)16(33)11-30-5-7-31(8-6-30)42(39,40)26(27,28)29/h2-4,14,32,35-36,38H,5-11H2,1H3 |
| InChIKey | QQSXCZIYYGYPHT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 181.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|