C23H22N2O9 — CID 170636701
(2R)-N-(2-formamidoethyl)-2,4,5,12-tetrahydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxamide (PubChem CID 170636701) has the molecular formula C23H22N2O9 and a molecular weight of 470.43 g/mol. Its IUPAC name is (2R)-N-(2-formamidoethyl)-2,4,5,12-tetrahydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxamide.
| Compound Name | (2R)-N-(2-formamidoethyl)-2,4,5,12-tetrahydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 170636701 |
| Molecular Formula | C23H22N2O9 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (2R)-N-(2-formamidoethyl)-2,4,5,12-tetrahydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxamide |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@](O)(C(=O)NCCNC=O)CC3O |
| InChI | InChI=1S/C23H22N2O9/c1-34-13-4-2-3-10-15(13)21(31)17-16(18(10)28)19(29)11-7-23(33,8-12(27)14(11)20(17)30)22(32)25-6-5-24-9-26/h2-4,9,12,27,29-30,33H,5-8H2,1H3,(H,24,26)(H,25,32)/t12?,23-/m1/s1 |
| InChIKey | BWLRCQZQWNPMLV-WHVUMMSNSA-N |
| XLogP | -0.55 |
| TPSA | 182.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|