C30H38O18P2 — CID 54310816
9-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoyl]-6,7,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 54310816) has the molecular formula C30H38O18P2 and a molecular weight of 748.56 g/mol. Its IUPAC name is 9-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoyl]-6,7,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 9-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoyl]-6,7,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 54310816 |
| Molecular Formula | C30H38O18P2 |
| Molecular Weight | 748.56 g/mol |
| Exact Mass | 748.15 |
| IUPAC Name | 9-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoyl]-6,7,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CCOOP(=O)(OOCC)C(CC(=O)C1(O)Cc2c(O)c3c(c(O)c2C(O)C1)C(=O)c1c(OC)cccc1C3=O)P(=O)(OOCC)OOCC |
| InChI | InChI=1S/C30H38O18P2/c1-6-41-45-49(38,46-42-7-2)21(50(39,47-43-8-3)48-44-9-4)13-20(32)30(37)14-17-22(18(31)15-30)28(35)25-24(27(17)34)26(33)16-11-10-12-19(40-5)23(16)29(25)36/h10-12,18,21,31,34-35,37H,6-9,13-15H2,1-5H3 |
| InChIKey | SKSZXOCVDUKOHV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 249.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|