C33H32N2O12 — CID 57129876
(7S,9S)-9-acetyl-4-[(4-aminophenoxy)methoxy]-6,9,11-trihydroxy-7-[4-(hydroxyamino)-6-methyl-5-oxooxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 57129876) has the molecular formula C33H32N2O12 and a molecular weight of 648.62 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-4-[(4-aminophenoxy)methoxy]-6,9,11-trihydroxy-7-[4-(hydroxyamino)-6-methyl-5-oxooxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-4-[(4-aminophenoxy)methoxy]-6,9,11-trihydroxy-7-[4-(hydroxyamino)-6-methyl-5-oxooxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 57129876 |
| Molecular Formula | C33H32N2O12 |
| Molecular Weight | 648.62 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | (7S,9S)-9-acetyl-4-[(4-aminophenoxy)methoxy]-6,9,11-trihydroxy-7-[4-(hydroxyamino)-6-methyl-5-oxooxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](OC2CC(NO)C(=O)C(C)O2)C1)C(=O)c1c(OCOc2ccc(N)cc2)cccc1C3=O |
| InChI | InChI=1S/C33H32N2O12/c1-14-28(37)20(35-43)10-23(46-14)47-22-12-33(42,15(2)36)11-19-25(22)32(41)27-26(30(19)39)29(38)18-4-3-5-21(24(18)31(27)40)45-13-44-17-8-6-16(34)7-9-17/h3-9,14,20,22-23,35,39,41-43H,10-13,34H2,1-2H3/t14?,20?,22-,23?,33-/m0/s1 |
| InChIKey | VQXDSQANOFZOSF-XRPQYFDISA-N |
| XLogP | 2.25 |
| TPSA | 224.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|